C23H22O6S — CID 55466660
[1-(4-ethylphenyl)-1-oxopropan-2-yl] 3-(benzenesulfonylmethyl)furan-2-carboxylate (PubChem CID 55466660) has the molecular formula C23H22O6S and a molecular weight of 426.49 g/mol. Its IUPAC name is [1-(4-ethylphenyl)-1-oxopropan-2-yl] 3-(benzenesulfonylmethyl)furan-2-carboxylate.
| Compound Name | [1-(4-ethylphenyl)-1-oxopropan-2-yl] 3-(benzenesulfonylmethyl)furan-2-carboxylate |
|---|---|
| PubChem CID | 55466660 |
| Molecular Formula | C23H22O6S |
| Molecular Weight | 426.49 g/mol |
| Exact Mass | 426.11 |
| IUPAC Name | [1-(4-ethylphenyl)-1-oxopropan-2-yl] 3-(benzenesulfonylmethyl)furan-2-carboxylate |
| SMILES | CCc1ccc(C(=O)C(C)OC(=O)c2occc2CS(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H22O6S/c1-3-17-9-11-18(12-10-17)21(24)16(2)29-23(25)22-19(13-14-28-22)15-30(26,27)20-7-5-4-6-8-20/h4-14,16H,3,15H2,1-2H3 |
| InChIKey | VLKASCPMPTXQEL-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 90.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.49 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |