C20H22O5S — CID 7752998
[(2R)-1-(4-ethylphenyl)-1-oxopropan-2-yl] 4-(methylsulfonylmethyl)benzoate (PubChem CID 7752998) has the molecular formula C20H22O5S and a molecular weight of 374.46 g/mol. Its IUPAC name is [(2R)-1-(4-ethylphenyl)-1-oxopropan-2-yl] 4-(methylsulfonylmethyl)benzoate.
| Compound Name | [(2R)-1-(4-ethylphenyl)-1-oxopropan-2-yl] 4-(methylsulfonylmethyl)benzoate |
|---|---|
| PubChem CID | 7752998 |
| Molecular Formula | C20H22O5S |
| Molecular Weight | 374.46 g/mol |
| Exact Mass | 374.12 |
| IUPAC Name | [(2R)-1-(4-ethylphenyl)-1-oxopropan-2-yl] 4-(methylsulfonylmethyl)benzoate |
| SMILES | CCc1ccc(C(=O)[C@@H](C)OC(=O)c2ccc(CS(C)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C20H22O5S/c1-4-15-5-9-17(10-6-15)19(21)14(2)25-20(22)18-11-7-16(8-12-18)13-26(3,23)24/h5-12,14H,4,13H2,1-3H3/t14-/m1/s1 |
| InChIKey | SJHOYTMNMHUYHV-CQSZACIVSA-N |
| XLogP | 3.22 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.46 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |