C20H21NO4 — CID 7949828
[(2R)-1-(4-ethylphenyl)-1-oxopropan-2-yl] 4-acetamidobenzoate (PubChem CID 7949828) has the molecular formula C20H21NO4 and a molecular weight of 339.39 g/mol. Its IUPAC name is [(2R)-1-(4-ethylphenyl)-1-oxopropan-2-yl] 4-acetamidobenzoate.
| Compound Name | [(2R)-1-(4-ethylphenyl)-1-oxopropan-2-yl] 4-acetamidobenzoate |
|---|---|
| PubChem CID | 7949828 |
| Molecular Formula | C20H21NO4 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | [(2R)-1-(4-ethylphenyl)-1-oxopropan-2-yl] 4-acetamidobenzoate |
| SMILES | CCc1ccc(C(=O)[C@@H](C)OC(=O)c2ccc(NC(C)=O)cc2)cc1 |
| InChI | InChI=1S/C20H21NO4/c1-4-15-5-7-16(8-6-15)19(23)13(2)25-20(24)17-9-11-18(12-10-17)21-14(3)22/h5-13H,4H2,1-3H3,(H,21,22)/t13-/m1/s1 |
| InChIKey | PUBODVDLFBBZAH-CYBMUJFWSA-N |
| XLogP | 3.64 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |