C25H23NO4 — CID 1342655
[(2S)-1-(4-methylphenyl)-1-oxopropan-2-yl] 4-[(2-phenylacetyl)amino]benzoate (PubChem CID 1342655) has the molecular formula C25H23NO4 and a molecular weight of 401.46 g/mol. Its IUPAC name is [(2S)-1-(4-methylphenyl)-1-oxopropan-2-yl] 4-[(2-phenylacetyl)amino]benzoate.
| Compound Name | [(2S)-1-(4-methylphenyl)-1-oxopropan-2-yl] 4-[(2-phenylacetyl)amino]benzoate |
|---|---|
| PubChem CID | 1342655 |
| Molecular Formula | C25H23NO4 |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.16 |
| IUPAC Name | [(2S)-1-(4-methylphenyl)-1-oxopropan-2-yl] 4-[(2-phenylacetyl)amino]benzoate |
| SMILES | Cc1ccc(C(=O)[C@H](C)OC(=O)c2ccc(NC(=O)Cc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C25H23NO4/c1-17-8-10-20(11-9-17)24(28)18(2)30-25(29)21-12-14-22(15-13-21)26-23(27)16-19-6-4-3-5-7-19/h3-15,18H,16H2,1-2H3,(H,26,27)/t18-/m0/s1 |
| InChIKey | MCYKOOCREMGHAY-SFHVURJKSA-N |
| XLogP | 4.60 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |