C23H22N2O3 — CID 112988583
methyl 4-[4-[[2-(4-methylphenyl)acetyl]amino]anilino]benzoate (PubChem CID 112988583) has the molecular formula C23H22N2O3 and a molecular weight of 374.44 g/mol. Its IUPAC name is methyl 4-[4-[[2-(4-methylphenyl)acetyl]amino]anilino]benzoate.
| Compound Name | methyl 4-[4-[[2-(4-methylphenyl)acetyl]amino]anilino]benzoate |
|---|---|
| PubChem CID | 112988583 |
| Molecular Formula | C23H22N2O3 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | methyl 4-[4-[[2-(4-methylphenyl)acetyl]amino]anilino]benzoate |
| SMILES | COC(=O)c1ccc(Nc2ccc(NC(=O)Cc3ccc(C)cc3)cc2)cc1 |
| InChI | InChI=1S/C23H22N2O3/c1-16-3-5-17(6-4-16)15-22(26)25-21-13-11-20(12-14-21)24-19-9-7-18(8-10-19)23(27)28-2/h3-14,24H,15H2,1-2H3,(H,25,26) |
| InChIKey | DXKYBWIRVIPYGG-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |