C26H26N2O8 — CID 51872840
bis[(2R)-1-(4-acetamidophenyl)-1-oxopropan-2-yl] (E)-but-2-enedioate (PubChem CID 51872840) has the molecular formula C26H26N2O8 and a molecular weight of 494.50 g/mol. Its IUPAC name is bis[(2R)-1-(4-acetamidophenyl)-1-oxopropan-2-yl] (E)-but-2-enedioate.
| Compound Name | bis[(2R)-1-(4-acetamidophenyl)-1-oxopropan-2-yl] (E)-but-2-enedioate |
|---|---|
| PubChem CID | 51872840 |
| Molecular Formula | C26H26N2O8 |
| Molecular Weight | 494.50 g/mol |
| Exact Mass | 494.17 |
| IUPAC Name | bis[(2R)-1-(4-acetamidophenyl)-1-oxopropan-2-yl] (E)-but-2-enedioate |
| SMILES | CC(=O)Nc1ccc(C(=O)[C@@H](C)OC(=O)/C=C/C(=O)O[C@H](C)C(=O)c2ccc(NC(C)=O)cc2)cc1 |
| InChI | InChI=1S/C26H26N2O8/c1-15(25(33)19-5-9-21(10-6-19)27-17(3)29)35-23(31)13-14-24(32)36-16(2)26(34)20-7-11-22(12-8-20)28-18(4)30/h5-16H,1-4H3,(H,27,29)(H,28,30)/b14-13+/t15-,16-/m1/s1 |
| InChIKey | PRRHELXETDHPNO-GHAJFHELSA-N |
| XLogP | 3.09 |
| TPSA | 144.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.50 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|