C17H20N2O4 — CID 3277277
[1-(4-acetamidoanilino)-1-oxopropan-2-yl] hexa-2,4-dienoate (PubChem CID 3277277) has the molecular formula C17H20N2O4 and a molecular weight of 316.36 g/mol. Its IUPAC name is [1-(4-acetamidoanilino)-1-oxopropan-2-yl] hexa-2,4-dienoate.
| Compound Name | [1-(4-acetamidoanilino)-1-oxopropan-2-yl] hexa-2,4-dienoate |
|---|---|
| PubChem CID | 3277277 |
| Molecular Formula | C17H20N2O4 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | [1-(4-acetamidoanilino)-1-oxopropan-2-yl] hexa-2,4-dienoate |
| SMILES | CC=CC=CC(=O)OC(C)C(=O)Nc1ccc(NC(C)=O)cc1 |
| InChI | InChI=1S/C17H20N2O4/c1-4-5-6-7-16(21)23-12(2)17(22)19-15-10-8-14(9-11-15)18-13(3)20/h4-12H,1-3H3,(H,18,20)(H,19,22) |
| InChIKey | YSKMRHDKJFUJFW-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|