C14H16BrNO3 — CID 8673311
[(2R)-1-(4-bromoanilino)-1-oxopropan-2-yl] (E)-pent-2-enoate (PubChem CID 8673311) has the molecular formula C14H16BrNO3 and a molecular weight of 326.19 g/mol. Its IUPAC name is [(2R)-1-(4-bromoanilino)-1-oxopropan-2-yl] (E)-pent-2-enoate.
| Compound Name | [(2R)-1-(4-bromoanilino)-1-oxopropan-2-yl] (E)-pent-2-enoate |
|---|---|
| PubChem CID | 8673311 |
| Molecular Formula | C14H16BrNO3 |
| Molecular Weight | 326.19 g/mol |
| Exact Mass | 325.03 |
| IUPAC Name | [(2R)-1-(4-bromoanilino)-1-oxopropan-2-yl] (E)-pent-2-enoate |
| SMILES | CC/C=C/C(=O)O[C@H](C)C(=O)Nc1ccc(Br)cc1 |
| InChI | InChI=1S/C14H16BrNO3/c1-3-4-5-13(17)19-10(2)14(18)16-12-8-6-11(15)7-9-12/h4-10H,3H2,1-2H3,(H,16,18)/b5-4+/t10-/m1/s1 |
| InChIKey | NGIZKPCROSVMCP-ORAHPGNNSA-N |
| XLogP | 3.29 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.19 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|