C19H21NO5S — CID 18171311
[1-[4-(methanesulfonamido)phenyl]-1-oxopropan-2-yl] 4-ethylbenzoate (PubChem CID 18171311) has the molecular formula C19H21NO5S and a molecular weight of 375.45 g/mol. Its IUPAC name is [1-[4-(methanesulfonamido)phenyl]-1-oxopropan-2-yl] 4-ethylbenzoate.
| Compound Name | [1-[4-(methanesulfonamido)phenyl]-1-oxopropan-2-yl] 4-ethylbenzoate |
|---|---|
| PubChem CID | 18171311 |
| Molecular Formula | C19H21NO5S |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.11 |
| IUPAC Name | [1-[4-(methanesulfonamido)phenyl]-1-oxopropan-2-yl] 4-ethylbenzoate |
| SMILES | CCc1ccc(C(=O)OC(C)C(=O)c2ccc(NS(C)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C19H21NO5S/c1-4-14-5-7-16(8-6-14)19(22)25-13(2)18(21)15-9-11-17(12-10-15)20-26(3,23)24/h5-13,20H,4H2,1-3H3 |
| InChIKey | UHADQTNAZHCPOA-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |