C16H15ClN2O5S — CID 46666462
[1-[4-(methanesulfonamido)phenyl]-1-oxopropan-2-yl] 2-chloropyridine-4-carboxylate (PubChem CID 46666462) has the molecular formula C16H15ClN2O5S and a molecular weight of 382.83 g/mol. Its IUPAC name is [1-[4-(methanesulfonamido)phenyl]-1-oxopropan-2-yl] 2-chloropyridine-4-carboxylate.
| Compound Name | [1-[4-(methanesulfonamido)phenyl]-1-oxopropan-2-yl] 2-chloropyridine-4-carboxylate |
|---|---|
| PubChem CID | 46666462 |
| Molecular Formula | C16H15ClN2O5S |
| Molecular Weight | 382.83 g/mol |
| Exact Mass | 382.04 |
| IUPAC Name | [1-[4-(methanesulfonamido)phenyl]-1-oxopropan-2-yl] 2-chloropyridine-4-carboxylate |
| SMILES | CC(OC(=O)c1ccnc(Cl)c1)C(=O)c1ccc(NS(C)(=O)=O)cc1 |
| InChI | InChI=1S/C16H15ClN2O5S/c1-10(24-16(21)12-7-8-18-14(17)9-12)15(20)11-3-5-13(6-4-11)19-25(2,22)23/h3-10,19H,1-2H3 |
| InChIKey | QEFFEILXCSFKSD-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 102.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.83 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|