C22H22N2O6S — CID 55466162
3-(benzenesulfonylmethyl)-N'-[2-(2-ethylphenoxy)acetyl]furan-2-carbohydrazide (PubChem CID 55466162) has the molecular formula C22H22N2O6S and a molecular weight of 442.49 g/mol. Its IUPAC name is 3-(benzenesulfonylmethyl)-N'-[2-(2-ethylphenoxy)acetyl]furan-2-carbohydrazide.
| Compound Name | 3-(benzenesulfonylmethyl)-N'-[2-(2-ethylphenoxy)acetyl]furan-2-carbohydrazide |
|---|---|
| PubChem CID | 55466162 |
| Molecular Formula | C22H22N2O6S |
| Molecular Weight | 442.49 g/mol |
| Exact Mass | 442.12 |
| IUPAC Name | 3-(benzenesulfonylmethyl)-N'-[2-(2-ethylphenoxy)acetyl]furan-2-carbohydrazide |
| SMILES | CCc1ccccc1OCC(=O)NNC(=O)c1occc1CS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C22H22N2O6S/c1-2-16-8-6-7-11-19(16)30-14-20(25)23-24-22(26)21-17(12-13-29-21)15-31(27,28)18-9-4-3-5-10-18/h3-13H,2,14-15H2,1H3,(H,23,25)(H,24,26) |
| InChIKey | UCLFJUIKKCVXCH-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 114.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.49 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|