C20H25NO4S — CID 51283677
3-(benzenesulfonylmethyl)-N-cyclooctylfuran-2-carboxamide (PubChem CID 51283677) has the molecular formula C20H25NO4S and a molecular weight of 375.49 g/mol. Its IUPAC name is 3-(benzenesulfonylmethyl)-N-cyclooctylfuran-2-carboxamide.
| Compound Name | 3-(benzenesulfonylmethyl)-N-cyclooctylfuran-2-carboxamide |
|---|---|
| PubChem CID | 51283677 |
| Molecular Formula | C20H25NO4S |
| Molecular Weight | 375.49 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | 3-(benzenesulfonylmethyl)-N-cyclooctylfuran-2-carboxamide |
| SMILES | O=C(NC1CCCCCCC1)c1occc1CS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C20H25NO4S/c22-20(21-17-9-5-2-1-3-6-10-17)19-16(13-14-25-19)15-26(23,24)18-11-7-4-8-12-18/h4,7-8,11-14,17H,1-3,5-6,9-10,15H2,(H,21,22) |
| InChIKey | AUWPBBHURUTELM-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.49 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |