C18H22N2O4S — CID 120554526
3-(benzenesulfonylmethyl)-N-(3-methylpiperidin-4-yl)furan-2-carboxamide (PubChem CID 120554526) has the molecular formula C18H22N2O4S and a molecular weight of 362.45 g/mol. Its IUPAC name is 3-(benzenesulfonylmethyl)-N-(3-methylpiperidin-4-yl)furan-2-carboxamide.
| Compound Name | 3-(benzenesulfonylmethyl)-N-(3-methylpiperidin-4-yl)furan-2-carboxamide |
|---|---|
| PubChem CID | 120554526 |
| Molecular Formula | C18H22N2O4S |
| Molecular Weight | 362.45 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | 3-(benzenesulfonylmethyl)-N-(3-methylpiperidin-4-yl)furan-2-carboxamide |
| SMILES | CC1CNCCC1NC(=O)c1occc1CS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C18H22N2O4S/c1-13-11-19-9-7-16(13)20-18(21)17-14(8-10-24-17)12-25(22,23)15-5-3-2-4-6-15/h2-6,8,10,13,16,19H,7,9,11-12H2,1H3,(H,20,21) |
| InChIKey | RDLPTDYQEIRRTI-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.45 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |