C16H19NO4S — CID 36711218
3-(benzenesulfonylmethyl)-N-butylfuran-2-carboxamide (PubChem CID 36711218) has the molecular formula C16H19NO4S and a molecular weight of 321.40 g/mol. Its IUPAC name is 3-(benzenesulfonylmethyl)-N-butylfuran-2-carboxamide.
| Compound Name | 3-(benzenesulfonylmethyl)-N-butylfuran-2-carboxamide |
|---|---|
| PubChem CID | 36711218 |
| Molecular Formula | C16H19NO4S |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | 3-(benzenesulfonylmethyl)-N-butylfuran-2-carboxamide |
| SMILES | CCCCNC(=O)c1occc1CS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C16H19NO4S/c1-2-3-10-17-16(18)15-13(9-11-21-15)12-22(19,20)14-7-5-4-6-8-14/h4-9,11H,2-3,10,12H2,1H3,(H,17,18) |
| InChIKey | WWUNJXPOSCXKQZ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|