C17H19NO2 — CID 46521947
N-cyclohexyl-3-phenylfuran-2-carboxamide (PubChem CID 46521947) has the molecular formula C17H19NO2 and a molecular weight of 269.34 g/mol. Its IUPAC name is N-cyclohexyl-3-phenylfuran-2-carboxamide.
| Compound Name | N-cyclohexyl-3-phenylfuran-2-carboxamide |
|---|---|
| PubChem CID | 46521947 |
| Molecular Formula | C17H19NO2 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | N-cyclohexyl-3-phenylfuran-2-carboxamide |
| SMILES | O=C(NC1CCCCC1)c1occc1-c1ccccc1 |
| InChI | InChI=1S/C17H19NO2/c19-17(18-14-9-5-2-6-10-14)16-15(11-12-20-16)13-7-3-1-4-8-13/h1,3-4,7-8,11-12,14H,2,5-6,9-10H2,(H,18,19) |
| InChIKey | CASAGGVHCAQKRE-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |