C22H22N2O2 — CID 15090685
N-cyclohexyl-2,4-diphenyl-1,3-oxazole-5-carboxamide (PubChem CID 15090685) has the molecular formula C22H22N2O2 and a molecular weight of 346.43 g/mol. Its IUPAC name is N-cyclohexyl-2,4-diphenyl-1,3-oxazole-5-carboxamide.
| Compound Name | N-cyclohexyl-2,4-diphenyl-1,3-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 15090685 |
| Molecular Formula | C22H22N2O2 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.17 |
| IUPAC Name | N-cyclohexyl-2,4-diphenyl-1,3-oxazole-5-carboxamide |
| SMILES | O=C(NC1CCCCC1)c1oc(-c2ccccc2)nc1-c1ccccc1 |
| InChI | InChI=1S/C22H22N2O2/c25-21(23-18-14-8-3-9-15-18)20-19(16-10-4-1-5-11-16)24-22(26-20)17-12-6-2-7-13-17/h1-2,4-7,10-13,18H,3,8-9,14-15H2,(H,23,25) |
| InChIKey | BHUFEFMVOIFTRO-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |