C19H24N2O2 — CID 110649225
N-cycloheptyl-2-(4-methyl-2-phenyl-1,3-oxazol-5-yl)acetamide (PubChem CID 110649225) has the molecular formula C19H24N2O2 and a molecular weight of 312.41 g/mol. Its IUPAC name is N-cycloheptyl-2-(4-methyl-2-phenyl-1,3-oxazol-5-yl)acetamide.
| Compound Name | N-cycloheptyl-2-(4-methyl-2-phenyl-1,3-oxazol-5-yl)acetamide |
|---|---|
| PubChem CID | 110649225 |
| Molecular Formula | C19H24N2O2 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | N-cycloheptyl-2-(4-methyl-2-phenyl-1,3-oxazol-5-yl)acetamide |
| SMILES | Cc1nc(-c2ccccc2)oc1CC(=O)NC1CCCCCC1 |
| InChI | InChI=1S/C19H24N2O2/c1-14-17(23-19(20-14)15-9-5-4-6-10-15)13-18(22)21-16-11-7-2-3-8-12-16/h4-6,9-10,16H,2-3,7-8,11-13H2,1H3,(H,21,22) |
| InChIKey | KULDXYOUEAZLSC-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |