C16H20N4O2 — CID 133482547
N-cyclohexyl-2-[(5-phenyl-1,2,4-oxadiazol-3-yl)amino]acetamide (PubChem CID 133482547) has the molecular formula C16H20N4O2 and a molecular weight of 300.36 g/mol. Its IUPAC name is N-cyclohexyl-2-[(5-phenyl-1,2,4-oxadiazol-3-yl)amino]acetamide.
| Compound Name | N-cyclohexyl-2-[(5-phenyl-1,2,4-oxadiazol-3-yl)amino]acetamide |
|---|---|
| PubChem CID | 133482547 |
| Molecular Formula | C16H20N4O2 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | N-cyclohexyl-2-[(5-phenyl-1,2,4-oxadiazol-3-yl)amino]acetamide |
| SMILES | O=C(CNc1noc(-c2ccccc2)n1)NC1CCCCC1 |
| InChI | InChI=1S/C16H20N4O2/c21-14(18-13-9-5-2-6-10-13)11-17-16-19-15(22-20-16)12-7-3-1-4-8-12/h1,3-4,7-8,13H,2,5-6,9-11H2,(H,17,20)(H,18,21) |
| InChIKey | LONJNMASVXYHKM-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 80.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |