C14H17N3O — CID 133481460
N-cyclohexyl-5-phenyl-1,2,4-oxadiazol-3-amine (PubChem CID 133481460) has the molecular formula C14H17N3O and a molecular weight of 243.31 g/mol. Its IUPAC name is N-cyclohexyl-5-phenyl-1,2,4-oxadiazol-3-amine.
| Compound Name | N-cyclohexyl-5-phenyl-1,2,4-oxadiazol-3-amine |
|---|---|
| PubChem CID | 133481460 |
| Molecular Formula | C14H17N3O |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.14 |
| IUPAC Name | N-cyclohexyl-5-phenyl-1,2,4-oxadiazol-3-amine |
| SMILES | c1ccc(-c2nc(NC3CCCCC3)no2)cc1 |
| InChI | InChI=1S/C14H17N3O/c1-3-7-11(8-4-1)13-16-14(17-18-13)15-12-9-5-2-6-10-12/h1,3-4,7-8,12H,2,5-6,9-10H2,(H,15,17) |
| InChIKey | KBARPBVUWDWVIM-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |