C17H22N4O — CID 133483006
N-[1-(2-methylprop-2-enyl)piperidin-4-yl]-5-phenyl-1,2,4-oxadiazol-3-amine (PubChem CID 133483006) has the molecular formula C17H22N4O and a molecular weight of 298.39 g/mol. Its IUPAC name is N-[1-(2-methylprop-2-enyl)piperidin-4-yl]-5-phenyl-1,2,4-oxadiazol-3-amine.
| Compound Name | N-[1-(2-methylprop-2-enyl)piperidin-4-yl]-5-phenyl-1,2,4-oxadiazol-3-amine |
|---|---|
| PubChem CID | 133483006 |
| Molecular Formula | C17H22N4O |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.18 |
| IUPAC Name | N-[1-(2-methylprop-2-enyl)piperidin-4-yl]-5-phenyl-1,2,4-oxadiazol-3-amine |
| SMILES | C=C(C)CN1CCC(Nc2noc(-c3ccccc3)n2)CC1 |
| InChI | InChI=1S/C17H22N4O/c1-13(2)12-21-10-8-15(9-11-21)18-17-19-16(22-20-17)14-6-4-3-5-7-14/h3-7,15H,1,8-12H2,2H3,(H,18,20) |
| InChIKey | DFLSPTKBRRRHNH-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 54.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|