C18H24N4O2 — CID 133319922
3-(3-methoxyphenyl)-N-[1-(2-methylprop-2-enyl)piperidin-4-yl]-1,2,4-oxadiazol-5-amine (PubChem CID 133319922) has the molecular formula C18H24N4O2 and a molecular weight of 328.42 g/mol. Its IUPAC name is 3-(3-methoxyphenyl)-N-[1-(2-methylprop-2-enyl)piperidin-4-yl]-1,2,4-oxadiazol-5-amine.
| Compound Name | 3-(3-methoxyphenyl)-N-[1-(2-methylprop-2-enyl)piperidin-4-yl]-1,2,4-oxadiazol-5-amine |
|---|---|
| PubChem CID | 133319922 |
| Molecular Formula | C18H24N4O2 |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | 3-(3-methoxyphenyl)-N-[1-(2-methylprop-2-enyl)piperidin-4-yl]-1,2,4-oxadiazol-5-amine |
| SMILES | C=C(C)CN1CCC(Nc2nc(-c3cccc(OC)c3)no2)CC1 |
| InChI | InChI=1S/C18H24N4O2/c1-13(2)12-22-9-7-15(8-10-22)19-18-20-17(21-24-18)14-5-4-6-16(11-14)23-3/h4-6,11,15H,1,7-10,12H2,2-3H3,(H,19,20,21) |
| InChIKey | LUUCUELQIMYZGZ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 63.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|