C17H23N3O3S — CID 133338190
N-(3-ethylsulfinylcyclohexyl)-3-(3-methoxyphenyl)-1,2,4-oxadiazol-5-amine (PubChem CID 133338190) has the molecular formula C17H23N3O3S and a molecular weight of 349.46 g/mol. Its IUPAC name is N-(3-ethylsulfinylcyclohexyl)-3-(3-methoxyphenyl)-1,2,4-oxadiazol-5-amine.
| Compound Name | N-(3-ethylsulfinylcyclohexyl)-3-(3-methoxyphenyl)-1,2,4-oxadiazol-5-amine |
|---|---|
| PubChem CID | 133338190 |
| Molecular Formula | C17H23N3O3S |
| Molecular Weight | 349.46 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | N-(3-ethylsulfinylcyclohexyl)-3-(3-methoxyphenyl)-1,2,4-oxadiazol-5-amine |
| SMILES | CCS(=O)C1CCCC(Nc2nc(-c3cccc(OC)c3)no2)C1 |
| InChI | InChI=1S/C17H23N3O3S/c1-3-24(21)15-9-5-7-13(11-15)18-17-19-16(20-23-17)12-6-4-8-14(10-12)22-2/h4,6,8,10,13,15H,3,5,7,9,11H2,1-2H3,(H,18,19,20) |
| InChIKey | MIAHSUKKIUXOBN-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.46 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |