C14H19N3O2 — CID 46342240
3-(3-methoxyphenyl)-N-(3-methylbutyl)-1,2,4-oxadiazol-5-amine (PubChem CID 46342240) has the molecular formula C14H19N3O2 and a molecular weight of 261.32 g/mol. Its IUPAC name is 3-(3-methoxyphenyl)-N-(3-methylbutyl)-1,2,4-oxadiazol-5-amine.
| Compound Name | 3-(3-methoxyphenyl)-N-(3-methylbutyl)-1,2,4-oxadiazol-5-amine |
|---|---|
| PubChem CID | 46342240 |
| Molecular Formula | C14H19N3O2 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | 3-(3-methoxyphenyl)-N-(3-methylbutyl)-1,2,4-oxadiazol-5-amine |
| SMILES | COc1cccc(-c2noc(NCCC(C)C)n2)c1 |
| InChI | InChI=1S/C14H19N3O2/c1-10(2)7-8-15-14-16-13(17-19-14)11-5-4-6-12(9-11)18-3/h4-6,9-10H,7-8H2,1-3H3,(H,15,16,17) |
| InChIKey | KQVCQDHOXIIPGR-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 60.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |