C20H21N5O2 — CID 133346672
3-(3-methoxyphenyl)-N-[3-(1-methylbenzimidazol-2-yl)propyl]-1,2,4-oxadiazol-5-amine (PubChem CID 133346672) has the molecular formula C20H21N5O2 and a molecular weight of 363.42 g/mol. Its IUPAC name is 3-(3-methoxyphenyl)-N-[3-(1-methylbenzimidazol-2-yl)propyl]-1,2,4-oxadiazol-5-amine.
| Compound Name | 3-(3-methoxyphenyl)-N-[3-(1-methylbenzimidazol-2-yl)propyl]-1,2,4-oxadiazol-5-amine |
|---|---|
| PubChem CID | 133346672 |
| Molecular Formula | C20H21N5O2 |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.17 |
| IUPAC Name | 3-(3-methoxyphenyl)-N-[3-(1-methylbenzimidazol-2-yl)propyl]-1,2,4-oxadiazol-5-amine |
| SMILES | COc1cccc(-c2noc(NCCCc3nc4ccccc4n3C)n2)c1 |
| InChI | InChI=1S/C20H21N5O2/c1-25-17-10-4-3-9-16(17)22-18(25)11-6-12-21-20-23-19(24-27-20)14-7-5-8-15(13-14)26-2/h3-5,7-10,13H,6,11-12H2,1-2H3,(H,21,23,24) |
| InChIKey | HALTWQCYNAEBAZ-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 78.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|