C17H21N5 — CID 133346658
4,6-dimethyl-N-[3-(1-methylbenzimidazol-2-yl)propyl]pyrimidin-2-amine (PubChem CID 133346658) has the molecular formula C17H21N5 and a molecular weight of 295.39 g/mol. Its IUPAC name is 4,6-dimethyl-N-[3-(1-methylbenzimidazol-2-yl)propyl]pyrimidin-2-amine.
| Compound Name | 4,6-dimethyl-N-[3-(1-methylbenzimidazol-2-yl)propyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 133346658 |
| Molecular Formula | C17H21N5 |
| Molecular Weight | 295.39 g/mol |
| Exact Mass | 295.18 |
| IUPAC Name | 4,6-dimethyl-N-[3-(1-methylbenzimidazol-2-yl)propyl]pyrimidin-2-amine |
| SMILES | Cc1cc(C)nc(NCCCc2nc3ccccc3n2C)n1 |
| InChI | InChI=1S/C17H21N5/c1-12-11-13(2)20-17(19-12)18-10-6-9-16-21-14-7-4-5-8-15(14)22(16)3/h4-5,7-8,11H,6,9-10H2,1-3H3,(H,18,19,20) |
| InChIKey | NZQYVHJEJDOWOI-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.39 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|