C18H23N5 — CID 133461518
6-ethyl-2-methyl-N-[3-(1-methylbenzimidazol-2-yl)propyl]pyrimidin-4-amine (PubChem CID 133461518) has the molecular formula C18H23N5 and a molecular weight of 309.42 g/mol. Its IUPAC name is 6-ethyl-2-methyl-N-[3-(1-methylbenzimidazol-2-yl)propyl]pyrimidin-4-amine.
| Compound Name | 6-ethyl-2-methyl-N-[3-(1-methylbenzimidazol-2-yl)propyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 133461518 |
| Molecular Formula | C18H23N5 |
| Molecular Weight | 309.42 g/mol |
| Exact Mass | 309.20 |
| IUPAC Name | 6-ethyl-2-methyl-N-[3-(1-methylbenzimidazol-2-yl)propyl]pyrimidin-4-amine |
| SMILES | CCc1cc(NCCCc2nc3ccccc3n2C)nc(C)n1 |
| InChI | InChI=1S/C18H23N5/c1-4-14-12-17(21-13(2)20-14)19-11-7-10-18-22-15-8-5-6-9-16(15)23(18)3/h5-6,8-9,12H,4,7,10-11H2,1-3H3,(H,19,20,21) |
| InChIKey | PAXMWPKFLVCCIG-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.42 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|