C16H19N5S — CID 133346760
N-[3-(1-methylbenzimidazol-2-yl)propyl]-6-methylsulfanylpyridazin-3-amine (PubChem CID 133346760) has the molecular formula C16H19N5S and a molecular weight of 313.43 g/mol. Its IUPAC name is N-[3-(1-methylbenzimidazol-2-yl)propyl]-6-methylsulfanylpyridazin-3-amine.
| Compound Name | N-[3-(1-methylbenzimidazol-2-yl)propyl]-6-methylsulfanylpyridazin-3-amine |
|---|---|
| PubChem CID | 133346760 |
| Molecular Formula | C16H19N5S |
| Molecular Weight | 313.43 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | N-[3-(1-methylbenzimidazol-2-yl)propyl]-6-methylsulfanylpyridazin-3-amine |
| SMILES | CSc1ccc(NCCCc2nc3ccccc3n2C)nn1 |
| InChI | InChI=1S/C16H19N5S/c1-21-13-7-4-3-6-12(13)18-15(21)8-5-11-17-14-9-10-16(22-2)20-19-14/h3-4,6-7,9-10H,5,8,11H2,1-2H3,(H,17,19) |
| InChIKey | PEFYLILNQQITOX-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.43 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|