C19H32IN3O2S — CID 109441134
1-(3-ethylsulfinylcyclohexyl)-3-[2-(3-methoxyphenyl)ethyl]-2-methylguanidine;hydroiodide (PubChem CID 109441134) has the molecular formula C19H32IN3O2S and a molecular weight of 493.46 g/mol. Its IUPAC name is 1-(3-ethylsulfinylcyclohexyl)-3-[2-(3-methoxyphenyl)ethyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-(3-ethylsulfinylcyclohexyl)-3-[2-(3-methoxyphenyl)ethyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 109441134 |
| Molecular Formula | C19H32IN3O2S |
| Molecular Weight | 493.46 g/mol |
| Exact Mass | 493.13 |
| IUPAC Name | 1-(3-ethylsulfinylcyclohexyl)-3-[2-(3-methoxyphenyl)ethyl]-2-methylguanidine;hydroiodide |
| SMILES | CCS(=O)C1CCCC(N/C(=N/C)NCCc2cccc(OC)c2)C1.I |
| InChI | InChI=1S/C19H31N3O2S.HI/c1-4-25(23)18-10-6-8-16(14-18)22-19(20-2)21-12-11-15-7-5-9-17(13-15)24-3;/h5,7,9,13,16,18H,4,6,8,10-12,14H2,1-3H3,(H2,20,21,22);1H |
| InChIKey | JMSKAYOYXHZANN-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.46 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|