C23H37IN4O3S — CID 109441146
N-cyclopropyl-2-[4-[2-[[N-(3-ethylsulfinylcyclohexyl)-N'-methylcarbamimidoyl]amino]ethyl]phenoxy]acetamide;hydroiodide (PubChem CID 109441146) has the molecular formula C23H37IN4O3S and a molecular weight of 576.55 g/mol. Its IUPAC name is N-cyclopropyl-2-[4-[2-[[N-(3-ethylsulfinylcyclohexyl)-N'-methylcarbamimidoyl]amino]ethyl]phenoxy]acetamide;hydroiodide.
| Compound Name | N-cyclopropyl-2-[4-[2-[[N-(3-ethylsulfinylcyclohexyl)-N'-methylcarbamimidoyl]amino]ethyl]phenoxy]acetamide;hydroiodide |
|---|---|
| PubChem CID | 109441146 |
| Molecular Formula | C23H37IN4O3S |
| Molecular Weight | 576.55 g/mol |
| Exact Mass | 576.16 |
| IUPAC Name | N-cyclopropyl-2-[4-[2-[[N-(3-ethylsulfinylcyclohexyl)-N'-methylcarbamimidoyl]amino]ethyl]phenoxy]acetamide;hydroiodide |
| SMILES | CCS(=O)C1CCCC(N/C(=N/C)NCCc2ccc(OCC(=O)NC3CC3)cc2)C1.I |
| InChI | InChI=1S/C23H36N4O3S.HI/c1-3-31(29)21-6-4-5-19(15-21)27-23(24-2)25-14-13-17-7-11-20(12-8-17)30-16-22(28)26-18-9-10-18;/h7-8,11-12,18-19,21H,3-6,9-10,13-16H2,1-2H3,(H,26,28)(H2,24,25,27);1H |
| InChIKey | VMEDGLQIJVDLLP-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 91.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.55 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|