C20H34IN3OS — CID 109438838
1-[2-(3,5-dimethylphenyl)ethyl]-3-(3-ethylsulfinylcyclohexyl)-2-methylguanidine;hydroiodide (PubChem CID 109438838) has the molecular formula C20H34IN3OS and a molecular weight of 491.48 g/mol. Its IUPAC name is 1-[2-(3,5-dimethylphenyl)ethyl]-3-(3-ethylsulfinylcyclohexyl)-2-methylguanidine;hydroiodide.
| Compound Name | 1-[2-(3,5-dimethylphenyl)ethyl]-3-(3-ethylsulfinylcyclohexyl)-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 109438838 |
| Molecular Formula | C20H34IN3OS |
| Molecular Weight | 491.48 g/mol |
| Exact Mass | 491.15 |
| IUPAC Name | 1-[2-(3,5-dimethylphenyl)ethyl]-3-(3-ethylsulfinylcyclohexyl)-2-methylguanidine;hydroiodide |
| SMILES | CCS(=O)C1CCCC(N/C(=N/C)NCCc2cc(C)cc(C)c2)C1.I |
| InChI | InChI=1S/C20H33N3OS.HI/c1-5-25(24)19-8-6-7-18(14-19)23-20(21-4)22-10-9-17-12-15(2)11-16(3)13-17;/h11-13,18-19H,5-10,14H2,1-4H3,(H2,21,22,23);1H |
| InChIKey | QUMKFGZXQCXNCC-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.48 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|