C21H36IN3OS — CID 109439424
1-(3-ethylsulfinylcyclohexyl)-2-methyl-3-[2-(2,4,6-trimethylphenyl)ethyl]guanidine;hydroiodide (PubChem CID 109439424) has the molecular formula C21H36IN3OS and a molecular weight of 505.51 g/mol. Its IUPAC name is 1-(3-ethylsulfinylcyclohexyl)-2-methyl-3-[2-(2,4,6-trimethylphenyl)ethyl]guanidine;hydroiodide.
| Compound Name | 1-(3-ethylsulfinylcyclohexyl)-2-methyl-3-[2-(2,4,6-trimethylphenyl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109439424 |
| Molecular Formula | C21H36IN3OS |
| Molecular Weight | 505.51 g/mol |
| Exact Mass | 505.16 |
| IUPAC Name | 1-(3-ethylsulfinylcyclohexyl)-2-methyl-3-[2-(2,4,6-trimethylphenyl)ethyl]guanidine;hydroiodide |
| SMILES | CCS(=O)C1CCCC(N/C(=N/C)NCCc2c(C)cc(C)cc2C)C1.I |
| InChI | InChI=1S/C21H35N3OS.HI/c1-6-26(25)19-9-7-8-18(14-19)24-21(22-5)23-11-10-20-16(3)12-15(2)13-17(20)4;/h12-13,18-19H,6-11,14H2,1-5H3,(H2,22,23,24);1H |
| InChIKey | DGHXLJIIARLEMB-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.51 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|