C18H28ClFIN3OS — CID 109439982
1-[2-(2-chloro-6-fluorophenyl)ethyl]-3-(3-ethylsulfinylcyclohexyl)-2-methylguanidine;hydroiodide (PubChem CID 109439982) has the molecular formula C18H28ClFIN3OS and a molecular weight of 515.86 g/mol. Its IUPAC name is 1-[2-(2-chloro-6-fluorophenyl)ethyl]-3-(3-ethylsulfinylcyclohexyl)-2-methylguanidine;hydroiodide.
| Compound Name | 1-[2-(2-chloro-6-fluorophenyl)ethyl]-3-(3-ethylsulfinylcyclohexyl)-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 109439982 |
| Molecular Formula | C18H28ClFIN3OS |
| Molecular Weight | 515.86 g/mol |
| Exact Mass | 515.07 |
| IUPAC Name | 1-[2-(2-chloro-6-fluorophenyl)ethyl]-3-(3-ethylsulfinylcyclohexyl)-2-methylguanidine;hydroiodide |
| SMILES | CCS(=O)C1CCCC(N/C(=N/C)NCCc2c(F)cccc2Cl)C1.I |
| InChI | InChI=1S/C18H27ClFN3OS.HI/c1-3-25(24)14-7-4-6-13(12-14)23-18(21-2)22-11-10-15-16(19)8-5-9-17(15)20;/h5,8-9,13-14H,3-4,6-7,10-12H2,1-2H3,(H2,21,22,23);1H |
| InChIKey | NICZWZRLEPULJT-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.86 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|