C19H29ClN4O2S — CID 109438257
2-chloro-N-[2-[[N-(3-ethylsulfinylcyclohexyl)-N'-methylcarbamimidoyl]amino]ethyl]benzamide (PubChem CID 109438257) has the molecular formula C19H29ClN4O2S and a molecular weight of 412.99 g/mol. Its IUPAC name is 2-chloro-N-[2-[[N-(3-ethylsulfinylcyclohexyl)-N'-methylcarbamimidoyl]amino]ethyl]benzamide.
| Compound Name | 2-chloro-N-[2-[[N-(3-ethylsulfinylcyclohexyl)-N'-methylcarbamimidoyl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 109438257 |
| Molecular Formula | C19H29ClN4O2S |
| Molecular Weight | 412.99 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | 2-chloro-N-[2-[[N-(3-ethylsulfinylcyclohexyl)-N'-methylcarbamimidoyl]amino]ethyl]benzamide |
| SMILES | CCS(=O)C1CCCC(N/C(=N/C)NCCNC(=O)c2ccccc2Cl)C1 |
| InChI | InChI=1S/C19H29ClN4O2S/c1-3-27(26)15-8-6-7-14(13-15)24-19(21-2)23-12-11-22-18(25)16-9-4-5-10-17(16)20/h4-5,9-10,14-15H,3,6-8,11-13H2,1-2H3,(H,22,25)(H2,21,23,24) |
| InChIKey | PVEDRRFXBMCMEL-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 82.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.99 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|