C18H30N4O3S2 — CID 109437723
1-[2-(benzenesulfonamido)ethyl]-3-(3-ethylsulfinylcyclohexyl)-2-methylguanidine (PubChem CID 109437723) has the molecular formula C18H30N4O3S2 and a molecular weight of 414.60 g/mol. Its IUPAC name is 1-[2-(benzenesulfonamido)ethyl]-3-(3-ethylsulfinylcyclohexyl)-2-methylguanidine.
| Compound Name | 1-[2-(benzenesulfonamido)ethyl]-3-(3-ethylsulfinylcyclohexyl)-2-methylguanidine |
|---|---|
| PubChem CID | 109437723 |
| Molecular Formula | C18H30N4O3S2 |
| Molecular Weight | 414.60 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | 1-[2-(benzenesulfonamido)ethyl]-3-(3-ethylsulfinylcyclohexyl)-2-methylguanidine |
| SMILES | CCS(=O)C1CCCC(N/C(=N/C)NCCNS(=O)(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C18H30N4O3S2/c1-3-26(23)16-9-7-8-15(14-16)22-18(19-2)20-12-13-21-27(24,25)17-10-5-4-6-11-17/h4-6,10-11,15-16,21H,3,7-9,12-14H2,1-2H3,(H2,19,20,22) |
| InChIKey | ULTWHLOVYSPTEY-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 99.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.60 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|