C22H31N3OS — CID 109438293
1-(3-ethylsulfinylcyclohexyl)-2-methyl-3-(2-naphthalen-2-ylethyl)guanidine (PubChem CID 109438293) has the molecular formula C22H31N3OS and a molecular weight of 385.58 g/mol. Its IUPAC name is 1-(3-ethylsulfinylcyclohexyl)-2-methyl-3-(2-naphthalen-2-ylethyl)guanidine.
| Compound Name | 1-(3-ethylsulfinylcyclohexyl)-2-methyl-3-(2-naphthalen-2-ylethyl)guanidine |
|---|---|
| PubChem CID | 109438293 |
| Molecular Formula | C22H31N3OS |
| Molecular Weight | 385.58 g/mol |
| Exact Mass | 385.22 |
| IUPAC Name | 1-(3-ethylsulfinylcyclohexyl)-2-methyl-3-(2-naphthalen-2-ylethyl)guanidine |
| SMILES | CCS(=O)C1CCCC(N/C(=N/C)NCCc2ccc3ccccc3c2)C1 |
| InChI | InChI=1S/C22H31N3OS/c1-3-27(26)21-10-6-9-20(16-21)25-22(23-2)24-14-13-17-11-12-18-7-4-5-8-19(18)15-17/h4-5,7-8,11-12,15,20-21H,3,6,9-10,13-14,16H2,1-2H3,(H2,23,24,25) |
| InChIKey | UVHRDLBLDNXDKH-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.58 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|