C20H34IN3OS — CID 109437020
1-(3-ethylsulfinylcyclohexyl)-2-methyl-3-(2-phenylbutyl)guanidine;hydroiodide (PubChem CID 109437020) has the molecular formula C20H34IN3OS and a molecular weight of 491.48 g/mol. Its IUPAC name is 1-(3-ethylsulfinylcyclohexyl)-2-methyl-3-(2-phenylbutyl)guanidine;hydroiodide.
| Compound Name | 1-(3-ethylsulfinylcyclohexyl)-2-methyl-3-(2-phenylbutyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 109437020 |
| Molecular Formula | C20H34IN3OS |
| Molecular Weight | 491.48 g/mol |
| Exact Mass | 491.15 |
| IUPAC Name | 1-(3-ethylsulfinylcyclohexyl)-2-methyl-3-(2-phenylbutyl)guanidine;hydroiodide |
| SMILES | CCC(CN/C(=N\C)NC1CCCC(S(=O)CC)C1)c1ccccc1.I |
| InChI | InChI=1S/C20H33N3OS.HI/c1-4-16(17-10-7-6-8-11-17)15-22-20(21-3)23-18-12-9-13-19(14-18)25(24)5-2;/h6-8,10-11,16,18-19H,4-5,9,12-15H2,1-3H3,(H2,21,22,23);1H |
| InChIKey | HGDHVMOGCHXUOB-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.48 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|