C19H29Cl2IN4O2S — CID 109437762
3,4-dichloro-N-[2-[[N-(3-ethylsulfinylcyclohexyl)-N'-methylcarbamimidoyl]amino]ethyl]benzamide;hydroiodide (PubChem CID 109437762) has the molecular formula C19H29Cl2IN4O2S and a molecular weight of 575.34 g/mol. Its IUPAC name is 3,4-dichloro-N-[2-[[N-(3-ethylsulfinylcyclohexyl)-N'-methylcarbamimidoyl]amino]ethyl]benzamide;hydroiodide.
| Compound Name | 3,4-dichloro-N-[2-[[N-(3-ethylsulfinylcyclohexyl)-N'-methylcarbamimidoyl]amino]ethyl]benzamide;hydroiodide |
|---|---|
| PubChem CID | 109437762 |
| Molecular Formula | C19H29Cl2IN4O2S |
| Molecular Weight | 575.34 g/mol |
| Exact Mass | 574.04 |
| IUPAC Name | 3,4-dichloro-N-[2-[[N-(3-ethylsulfinylcyclohexyl)-N'-methylcarbamimidoyl]amino]ethyl]benzamide;hydroiodide |
| SMILES | CCS(=O)C1CCCC(N/C(=N/C)NCCNC(=O)c2ccc(Cl)c(Cl)c2)C1.I |
| InChI | InChI=1S/C19H28Cl2N4O2S.HI/c1-3-28(27)15-6-4-5-14(12-15)25-19(22-2)24-10-9-23-18(26)13-7-8-16(20)17(21)11-13;/h7-8,11,14-15H,3-6,9-10,12H2,1-2H3,(H,23,26)(H2,22,24,25);1H |
| InChIKey | YYWGXRLVVODVIN-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 82.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.34 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|