C18H25F3N4O2 — CID 109471417
N-cyclopropyl-2-[4-[2-[[N'-methyl-N-(3,3,3-trifluoropropyl)carbamimidoyl]amino]ethyl]phenoxy]acetamide (PubChem CID 109471417) has the molecular formula C18H25F3N4O2 and a molecular weight of 386.42 g/mol. Its IUPAC name is N-cyclopropyl-2-[4-[2-[[N'-methyl-N-(3,3,3-trifluoropropyl)carbamimidoyl]amino]ethyl]phenoxy]acetamide.
| Compound Name | N-cyclopropyl-2-[4-[2-[[N'-methyl-N-(3,3,3-trifluoropropyl)carbamimidoyl]amino]ethyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 109471417 |
| Molecular Formula | C18H25F3N4O2 |
| Molecular Weight | 386.42 g/mol |
| Exact Mass | 386.19 |
| IUPAC Name | N-cyclopropyl-2-[4-[2-[[N'-methyl-N-(3,3,3-trifluoropropyl)carbamimidoyl]amino]ethyl]phenoxy]acetamide |
| SMILES | C/N=C(/NCCc1ccc(OCC(=O)NC2CC2)cc1)NCCC(F)(F)F |
| InChI | InChI=1S/C18H25F3N4O2/c1-22-17(24-11-9-18(19,20)21)23-10-8-13-2-6-15(7-3-13)27-12-16(26)25-14-4-5-14/h2-3,6-7,14H,4-5,8-12H2,1H3,(H,25,26)(H2,22,23,24) |
| InChIKey | OBFZEHWADDBQHH-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.42 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|