C23H30N4O2S — CID 111372779
N-cyclopropyl-2-[4-[2-[[N'-methyl-N-(2-phenylsulfanylethyl)carbamimidoyl]amino]ethyl]phenoxy]acetamide (PubChem CID 111372779) has the molecular formula C23H30N4O2S and a molecular weight of 426.59 g/mol. Its IUPAC name is N-cyclopropyl-2-[4-[2-[[N'-methyl-N-(2-phenylsulfanylethyl)carbamimidoyl]amino]ethyl]phenoxy]acetamide.
| Compound Name | N-cyclopropyl-2-[4-[2-[[N'-methyl-N-(2-phenylsulfanylethyl)carbamimidoyl]amino]ethyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 111372779 |
| Molecular Formula | C23H30N4O2S |
| Molecular Weight | 426.59 g/mol |
| Exact Mass | 426.21 |
| IUPAC Name | N-cyclopropyl-2-[4-[2-[[N'-methyl-N-(2-phenylsulfanylethyl)carbamimidoyl]amino]ethyl]phenoxy]acetamide |
| SMILES | C/N=C(\NCCSc1ccccc1)NCCc1ccc(OCC(=O)NC2CC2)cc1 |
| InChI | InChI=1S/C23H30N4O2S/c1-24-23(26-15-16-30-21-5-3-2-4-6-21)25-14-13-18-7-11-20(12-8-18)29-17-22(28)27-19-9-10-19/h2-8,11-12,19H,9-10,13-17H2,1H3,(H,27,28)(H2,24,25,26) |
| InChIKey | FLLBSFKVJPXMEN-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.59 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|