C22H38IN3O3S — CID 109439476
1-[3-(3-ethoxy-4-methoxyphenyl)propyl]-3-(3-ethylsulfinylcyclohexyl)-2-methylguanidine;hydroiodide (PubChem CID 109439476) has the molecular formula C22H38IN3O3S and a molecular weight of 551.54 g/mol. Its IUPAC name is 1-[3-(3-ethoxy-4-methoxyphenyl)propyl]-3-(3-ethylsulfinylcyclohexyl)-2-methylguanidine;hydroiodide.
| Compound Name | 1-[3-(3-ethoxy-4-methoxyphenyl)propyl]-3-(3-ethylsulfinylcyclohexyl)-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 109439476 |
| Molecular Formula | C22H38IN3O3S |
| Molecular Weight | 551.54 g/mol |
| Exact Mass | 551.17 |
| IUPAC Name | 1-[3-(3-ethoxy-4-methoxyphenyl)propyl]-3-(3-ethylsulfinylcyclohexyl)-2-methylguanidine;hydroiodide |
| SMILES | CCOc1cc(CCCN/C(=N\C)NC2CCCC(S(=O)CC)C2)ccc1OC.I |
| InChI | InChI=1S/C22H37N3O3S.HI/c1-5-28-21-15-17(12-13-20(21)27-4)9-8-14-24-22(23-3)25-18-10-7-11-19(16-18)29(26)6-2;/h12-13,15,18-19H,5-11,14,16H2,1-4H3,(H2,23,24,25);1H |
| InChIKey | XCUKQFVCAJKZEW-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.54 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|