C12H13N3O2 — CID 120841721
5-[(2R)-azetidin-2-yl]-3-(3-methoxyphenyl)-1,2,4-oxadiazole (PubChem CID 120841721) has the molecular formula C12H13N3O2 and a molecular weight of 231.25 g/mol. Its IUPAC name is 5-[(2R)-azetidin-2-yl]-3-(3-methoxyphenyl)-1,2,4-oxadiazole.
| Compound Name | 5-[(2R)-azetidin-2-yl]-3-(3-methoxyphenyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 120841721 |
| Molecular Formula | C12H13N3O2 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.10 |
| IUPAC Name | 5-[(2R)-azetidin-2-yl]-3-(3-methoxyphenyl)-1,2,4-oxadiazole |
| SMILES | COc1cccc(-c2noc([C@H]3CCN3)n2)c1 |
| InChI | InChI=1S/C12H13N3O2/c1-16-9-4-2-3-8(7-9)11-14-12(17-15-11)10-5-6-13-10/h2-4,7,10,13H,5-6H2,1H3/t10-/m1/s1 |
| InChIKey | HFHVDXBQGXHQHT-SNVBAGLBSA-N |
| XLogP | 1.78 |
| TPSA | 60.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |