About 3-(3-methylphenyl)-5-piperidin-2-yl-1,2,4-oxadiazole
3-(3-methylphenyl)-5-piperidin-2-yl-1,2,4-oxadiazole (PubChem CID 43109257) has the molecular formula C14H17N3O
and a molecular weight of 243.31 g/mol. Its IUPAC name is 3-(3-methylphenyl)-5-piperidin-2-yl-1,2,4-oxadiazole.
Molecular Properties
| Compound Name | 3-(3-methylphenyl)-5-piperidin-2-yl-1,2,4-oxadiazole |
| PubChem CID | 43109257 |
| Molecular Formula | C14H17N3O |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.14 |
| IUPAC Name | 3-(3-methylphenyl)-5-piperidin-2-yl-1,2,4-oxadiazole |
| SMILES | Cc1cccc(-c2noc(C3CCCCN3)n2)c1 |
| InChI | InChI=1S/C14H17N3O/c1-10-5-4-6-11(9-10)13-16-14(18-17-13)12-7-2-3-8-15-12/h4-6,9,12,15H,2-3,7-8H2,1H3 |
| InChIKey | HYNYOFKMSLQLEU-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(3-methylphenyl)-5-piperidin-2-yl-1,2,4-oxadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-methylphenyl)-5-piperidin-2-yl-1,2,4-oxadiazole?
The IUPAC name of 3-(3-methylphenyl)-5-piperidin-2-yl-1,2,4-oxadiazole (CID 43109257) is 3-(3-methylphenyl)-5-piperidin-2-yl-1,2,4-oxadiazole.
What is the SMILES notation for 3-(3-methylphenyl)-5-piperidin-2-yl-1,2,4-oxadiazole?
The canonical SMILES for 3-(3-methylphenyl)-5-piperidin-2-yl-1,2,4-oxadiazole is Cc1cccc(-c2noc(C3CCCCN3)n2)c1.
What is the InChIKey of 3-(3-methylphenyl)-5-piperidin-2-yl-1,2,4-oxadiazole?
The InChIKey is HYNYOFKMSLQLEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17N3O/c1-10-5-4-6-11(9-10)13-16-14(18-17-13)12-7-2-3-8-15-12/h4-6,9,12,15H,2-3,7-8H2,1H3.
What are the key properties of 3-(3-methylphenyl)-5-piperidin-2-yl-1,2,4-oxadiazole?
3-(3-methylphenyl)-5-piperidin-2-yl-1,2,4-oxadiazole has a molecular weight of 243.31 g/mol, XLogP of 2.86, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-methylphenyl)-5-piperidin-2-yl-1,2,4-oxadiazole is sourced from PubChem (CID 43109257), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).