C15H15N5O — CID 104914946
5-[(2R)-piperidin-2-yl]-3-quinoxalin-6-yl-1,2,4-oxadiazole (PubChem CID 104914946) has the molecular formula C15H15N5O and a molecular weight of 281.32 g/mol. Its IUPAC name is 5-[(2R)-piperidin-2-yl]-3-quinoxalin-6-yl-1,2,4-oxadiazole.
| Compound Name | 5-[(2R)-piperidin-2-yl]-3-quinoxalin-6-yl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 104914946 |
| Molecular Formula | C15H15N5O |
| Molecular Weight | 281.32 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | 5-[(2R)-piperidin-2-yl]-3-quinoxalin-6-yl-1,2,4-oxadiazole |
| SMILES | c1cnc2cc(-c3noc([C@H]4CCCCN4)n3)ccc2n1 |
| InChI | InChI=1S/C15H15N5O/c1-2-6-16-12(3-1)15-19-14(20-21-15)10-4-5-11-13(9-10)18-8-7-17-11/h4-5,7-9,12,16H,1-3,6H2/t12-/m1/s1 |
| InChIKey | MBBLSWVEMRQOPM-GFCCVEGCSA-N |
| XLogP | 2.49 |
| TPSA | 76.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.32 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |