C13H12F3N3O — CID 103832702
5-[(2S)-piperidin-2-yl]-3-(3,4,5-trifluorophenyl)-1,2,4-oxadiazole (PubChem CID 103832702) has the molecular formula C13H12F3N3O and a molecular weight of 283.25 g/mol. Its IUPAC name is 5-[(2S)-piperidin-2-yl]-3-(3,4,5-trifluorophenyl)-1,2,4-oxadiazole.
| Compound Name | 5-[(2S)-piperidin-2-yl]-3-(3,4,5-trifluorophenyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 103832702 |
| Molecular Formula | C13H12F3N3O |
| Molecular Weight | 283.25 g/mol |
| Exact Mass | 283.09 |
| IUPAC Name | 5-[(2S)-piperidin-2-yl]-3-(3,4,5-trifluorophenyl)-1,2,4-oxadiazole |
| SMILES | Fc1cc(-c2noc([C@@H]3CCCCN3)n2)cc(F)c1F |
| InChI | InChI=1S/C13H12F3N3O/c14-8-5-7(6-9(15)11(8)16)12-18-13(20-19-12)10-3-1-2-4-17-10/h5-6,10,17H,1-4H2/t10-/m0/s1 |
| InChIKey | SCBORRXKOLNDAV-JTQLQIEISA-N |
| XLogP | 2.97 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.25 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|