C11H13N3O2 — CID 104914944
3-(furan-3-yl)-5-[(2S)-piperidin-2-yl]-1,2,4-oxadiazole (PubChem CID 104914944) has the molecular formula C11H13N3O2 and a molecular weight of 219.24 g/mol. Its IUPAC name is 3-(furan-3-yl)-5-[(2S)-piperidin-2-yl]-1,2,4-oxadiazole.
| Compound Name | 3-(furan-3-yl)-5-[(2S)-piperidin-2-yl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 104914944 |
| Molecular Formula | C11H13N3O2 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.10 |
| IUPAC Name | 3-(furan-3-yl)-5-[(2S)-piperidin-2-yl]-1,2,4-oxadiazole |
| SMILES | c1cc(-c2noc([C@@H]3CCCCN3)n2)co1 |
| InChI | InChI=1S/C11H13N3O2/c1-2-5-12-9(3-1)11-13-10(14-16-11)8-4-6-15-7-8/h4,6-7,9,12H,1-3,5H2/t9-/m0/s1 |
| InChIKey | REUQKLQMLCRHMS-VIFPVBQESA-N |
| XLogP | 2.14 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |