C12H12FN3O — CID 3998388
3-(4-fluorophenyl)-5-pyrrolidin-2-yl-1,2,4-oxadiazole (PubChem CID 3998388) has the molecular formula C12H12FN3O and a molecular weight of 233.25 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-5-pyrrolidin-2-yl-1,2,4-oxadiazole.
| Compound Name | 3-(4-fluorophenyl)-5-pyrrolidin-2-yl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 3998388 |
| Molecular Formula | C12H12FN3O |
| Molecular Weight | 233.25 g/mol |
| Exact Mass | 233.10 |
| IUPAC Name | 3-(4-fluorophenyl)-5-pyrrolidin-2-yl-1,2,4-oxadiazole |
| SMILES | Fc1ccc(-c2noc(C3CCCN3)n2)cc1 |
| InChI | InChI=1S/C12H12FN3O/c13-9-5-3-8(4-6-9)11-15-12(17-16-11)10-2-1-7-14-10/h3-6,10,14H,1-2,7H2 |
| InChIKey | MNMVPVCQOZPXSE-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.25 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |