C18H22N2O2 — CID 110647492
N-cyclohexyl-2-(4-methyl-2-phenyl-1,3-oxazol-5-yl)acetamide (PubChem CID 110647492) has the molecular formula C18H22N2O2 and a molecular weight of 298.39 g/mol. Its IUPAC name is N-cyclohexyl-2-(4-methyl-2-phenyl-1,3-oxazol-5-yl)acetamide.
| Compound Name | N-cyclohexyl-2-(4-methyl-2-phenyl-1,3-oxazol-5-yl)acetamide |
|---|---|
| PubChem CID | 110647492 |
| Molecular Formula | C18H22N2O2 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | N-cyclohexyl-2-(4-methyl-2-phenyl-1,3-oxazol-5-yl)acetamide |
| SMILES | Cc1nc(-c2ccccc2)oc1CC(=O)NC1CCCCC1 |
| InChI | InChI=1S/C18H22N2O2/c1-13-16(12-17(21)20-15-10-6-3-7-11-15)22-18(19-13)14-8-4-2-5-9-14/h2,4-5,8-9,15H,3,6-7,10-12H2,1H3,(H,20,21) |
| InChIKey | MNDOMIRBSKPGGR-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |