C15H17N3O2 — CID 22431707
N-cyclohexyl-5-phenyl-1,3,4-oxadiazole-2-carboxamide (PubChem CID 22431707) has the molecular formula C15H17N3O2 and a molecular weight of 271.32 g/mol. Its IUPAC name is N-cyclohexyl-5-phenyl-1,3,4-oxadiazole-2-carboxamide.
| Compound Name | N-cyclohexyl-5-phenyl-1,3,4-oxadiazole-2-carboxamide |
|---|---|
| PubChem CID | 22431707 |
| Molecular Formula | C15H17N3O2 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.13 |
| IUPAC Name | N-cyclohexyl-5-phenyl-1,3,4-oxadiazole-2-carboxamide |
| SMILES | O=C(NC1CCCCC1)c1nnc(-c2ccccc2)o1 |
| InChI | InChI=1S/C15H17N3O2/c19-13(16-12-9-5-2-6-10-12)15-18-17-14(20-15)11-7-3-1-4-8-11/h1,3-4,7-8,12H,2,5-6,9-10H2,(H,16,19) |
| InChIKey | LJOCPBBGQLZOFH-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |