C18H22ClN3O2 — CID 22431938
5-[(2-chlorophenyl)methyl]-N-cyclooctyl-1,3,4-oxadiazole-2-carboxamide (PubChem CID 22431938) has the molecular formula C18H22ClN3O2 and a molecular weight of 347.85 g/mol. Its IUPAC name is 5-[(2-chlorophenyl)methyl]-N-cyclooctyl-1,3,4-oxadiazole-2-carboxamide.
| Compound Name | 5-[(2-chlorophenyl)methyl]-N-cyclooctyl-1,3,4-oxadiazole-2-carboxamide |
|---|---|
| PubChem CID | 22431938 |
| Molecular Formula | C18H22ClN3O2 |
| Molecular Weight | 347.85 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | 5-[(2-chlorophenyl)methyl]-N-cyclooctyl-1,3,4-oxadiazole-2-carboxamide |
| SMILES | O=C(NC1CCCCCCC1)c1nnc(Cc2ccccc2Cl)o1 |
| InChI | InChI=1S/C18H22ClN3O2/c19-15-11-7-6-8-13(15)12-16-21-22-18(24-16)17(23)20-14-9-4-2-1-3-5-10-14/h6-8,11,14H,1-5,9-10,12H2,(H,20,23) |
| InChIKey | BRPDPSBQTNFHDV-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.85 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |