About N-cyclopropyl-5-phenyl-1,3,4-oxadiazole-2-carboxamide
N-cyclopropyl-5-phenyl-1,3,4-oxadiazole-2-carboxamide (PubChem CID 22431746) has the molecular formula C12H11N3O2
and a molecular weight of 229.24 g/mol. Its IUPAC name is N-cyclopropyl-5-phenyl-1,3,4-oxadiazole-2-carboxamide.
Molecular Properties
| Compound Name | N-cyclopropyl-5-phenyl-1,3,4-oxadiazole-2-carboxamide |
| PubChem CID | 22431746 |
| Molecular Formula | C12H11N3O2 |
| Molecular Weight | 229.24 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | N-cyclopropyl-5-phenyl-1,3,4-oxadiazole-2-carboxamide |
| SMILES | O=C(NC1CC1)c1nnc(-c2ccccc2)o1 |
| InChI | InChI=1S/C12H11N3O2/c16-10(13-9-6-7-9)12-15-14-11(17-12)8-4-2-1-3-5-8/h1-5,9H,6-7H2,(H,13,16) |
| InChIKey | YJFUONHUEOVIIA-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.24 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-cyclopropyl-5-phenyl-1,3,4-oxadiazole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopropyl-5-phenyl-1,3,4-oxadiazole-2-carboxamide?
The IUPAC name of N-cyclopropyl-5-phenyl-1,3,4-oxadiazole-2-carboxamide (CID 22431746) is N-cyclopropyl-5-phenyl-1,3,4-oxadiazole-2-carboxamide.
What is the SMILES notation for N-cyclopropyl-5-phenyl-1,3,4-oxadiazole-2-carboxamide?
The canonical SMILES for N-cyclopropyl-5-phenyl-1,3,4-oxadiazole-2-carboxamide is O=C(NC1CC1)c1nnc(-c2ccccc2)o1.
What is the InChIKey of N-cyclopropyl-5-phenyl-1,3,4-oxadiazole-2-carboxamide?
The InChIKey is YJFUONHUEOVIIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11N3O2/c16-10(13-9-6-7-9)12-15-14-11(17-12)8-4-2-1-3-5-8/h1-5,9H,6-7H2,(H,13,16).
What are the key properties of N-cyclopropyl-5-phenyl-1,3,4-oxadiazole-2-carboxamide?
N-cyclopropyl-5-phenyl-1,3,4-oxadiazole-2-carboxamide has a molecular weight of 229.24 g/mol, XLogP of 1.63, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopropyl-5-phenyl-1,3,4-oxadiazole-2-carboxamide is sourced from PubChem (CID 22431746), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).